C26H33ClN2O5 — CID 143312453
7-chloro-1-[4-(2,3-dihydroxypropoxy)phenyl]-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole-2-carbaldehyde;2-methoxypropane (PubChem CID 143312453) has the molecular formula C26H33ClN2O5 and a molecular weight of 489.01 g/mol. Its IUPAC name is 7-chloro-1-[4-(2,3-dihydroxypropoxy)phenyl]-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole-2-carbaldehyde;2-methoxypropane.
| Compound Name | 7-chloro-1-[4-(2,3-dihydroxypropoxy)phenyl]-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole-2-carbaldehyde;2-methoxypropane |
|---|---|
| PubChem CID | 143312453 |
| Molecular Formula | C26H33ClN2O5 |
| Molecular Weight | 489.01 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 7-chloro-1-[4-(2,3-dihydroxypropoxy)phenyl]-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole-2-carbaldehyde;2-methoxypropane |
| SMILES | COC(C)C.O=CN1CCCc2c([nH]c3ccc(Cl)cc23)C1c1ccc(OCC(O)CO)cc1 |
| InChI | InChI=1S/C22H23ClN2O4.C4H10O/c23-15-5-8-20-19(10-15)18-2-1-9-25(13-27)22(21(18)24-20)14-3-6-17(7-4-14)29-12-16(28)11-26;1-4(2)5-3/h3-8,10,13,16,22,24,26,28H,1-2,9,11-12H2;4H,1-3H3 |
| InChIKey | WZPDUECWRZLCLD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.01 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|