C26H24ClFN2O3 — CID 143312523
6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde;4-fluorocyclohepta-1,3,5-trien-1-ol (PubChem CID 143312523) has the molecular formula C26H24ClFN2O3 and a molecular weight of 466.94 g/mol. Its IUPAC name is 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde;4-fluorocyclohepta-1,3,5-trien-1-ol.
| Compound Name | 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde;4-fluorocyclohepta-1,3,5-trien-1-ol |
|---|---|
| PubChem CID | 143312523 |
| Molecular Formula | C26H24ClFN2O3 |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde;4-fluorocyclohepta-1,3,5-trien-1-ol |
| SMILES | COc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C=O)cc1.OC1=CC=C(F)C=CC1 |
| InChI | InChI=1S/C19H17ClN2O2.C7H7FO/c1-24-14-5-2-12(3-6-14)19-18-15(8-9-22(19)11-23)16-10-13(20)4-7-17(16)21-18;8-6-2-1-3-7(9)5-4-6/h2-7,10-11,19,21H,8-9H2,1H3;1-2,4-5,9H,3H2 |
| InChIKey | LGPSXJMJWPALEQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|