C24H21ClN2O3S — CID 171354809
2-(benzenesulfonyl)-6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 171354809) has the molecular formula C24H21ClN2O3S and a molecular weight of 452.96 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-(benzenesulfonyl)-6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 171354809 |
| Molecular Formula | C24H21ClN2O3S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 2-(benzenesulfonyl)-6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | COc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21ClN2O3S/c1-30-18-10-7-16(8-11-18)24-23-20(21-15-17(25)9-12-22(21)26-23)13-14-27(24)31(28,29)19-5-3-2-4-6-19/h2-12,15,24,26H,13-14H2,1H3 |
| InChIKey | UFDGSICZSCOVLL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|