C35H30N2O4S2 — CID 166353475
6-methoxy-2-[4-(4-methylsulfanylphenoxy)phenyl]sulfonyl-1-naphthalen-1-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 166353475) has the molecular formula C35H30N2O4S2 and a molecular weight of 606.77 g/mol. Its IUPAC name is 6-methoxy-2-[4-(4-methylsulfanylphenoxy)phenyl]sulfonyl-1-naphthalen-1-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 6-methoxy-2-[4-(4-methylsulfanylphenoxy)phenyl]sulfonyl-1-naphthalen-1-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 166353475 |
| Molecular Formula | C35H30N2O4S2 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.16 |
| IUPAC Name | 6-methoxy-2-[4-(4-methylsulfanylphenoxy)phenyl]sulfonyl-1-naphthalen-1-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(S(=O)(=O)c1ccc(Oc2ccc(SC)cc2)cc1)C3c1cccc2ccccc12 |
| InChI | InChI=1S/C35H30N2O4S2/c1-40-26-14-19-33-32(22-26)30-20-21-37(35(34(30)36-33)31-9-5-7-23-6-3-4-8-29(23)31)43(38,39)28-17-12-25(13-18-28)41-24-10-15-27(42-2)16-11-24/h3-19,22,35-36H,20-21H2,1-2H3 |
| InChIKey | LEJFMFMHXZJBBJ-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|