C26H26N2O2S2 — CID 92870624
(1S)-2-(3,4-dimethylphenyl)sulfonyl-1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 92870624) has the molecular formula C26H26N2O2S2 and a molecular weight of 462.64 g/mol. Its IUPAC name is (1S)-2-(3,4-dimethylphenyl)sulfonyl-1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S)-2-(3,4-dimethylphenyl)sulfonyl-1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 92870624 |
| Molecular Formula | C26H26N2O2S2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | (1S)-2-(3,4-dimethylphenyl)sulfonyl-1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CSc1ccc([C@H]2c3[nH]c4ccccc4c3CCN2S(=O)(=O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C26H26N2O2S2/c1-17-8-13-21(16-18(17)2)32(29,30)28-15-14-23-22-6-4-5-7-24(22)27-25(23)26(28)19-9-11-20(31-3)12-10-19/h4-13,16,26-27H,14-15H2,1-3H3/t26-/m0/s1 |
| InChIKey | YKYHMBKKQRKUCS-SANMLTNESA-N |
| XLogP | 5.84 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|