C24H21ClN2O2S — CID 92889554
(1R)-1-(4-chlorophenyl)-2-(2-methylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 92889554) has the molecular formula C24H21ClN2O2S and a molecular weight of 436.96 g/mol. Its IUPAC name is (1R)-1-(4-chlorophenyl)-2-(2-methylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R)-1-(4-chlorophenyl)-2-(2-methylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 92889554 |
| Molecular Formula | C24H21ClN2O2S |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | (1R)-1-(4-chlorophenyl)-2-(2-methylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | Cc1ccccc1S(=O)(=O)N1CCc2c([nH]c3ccccc23)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H21ClN2O2S/c1-16-6-2-5-9-22(16)30(28,29)27-15-14-20-19-7-3-4-8-21(19)26-23(20)24(27)17-10-12-18(25)13-11-17/h2-13,24,26H,14-15H2,1H3/t24-/m1/s1 |
| InChIKey | WPXFWZHNFDWLIF-XMMPIXPASA-N |
| XLogP | 5.47 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|