C26H26N2O2S — CID 46328289
2-(3,4-dimethylphenyl)sulfonyl-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 46328289) has the molecular formula C26H26N2O2S and a molecular weight of 430.57 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)sulfonyl-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-(3,4-dimethylphenyl)sulfonyl-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 46328289 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2-(3,4-dimethylphenyl)sulfonyl-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | Cc1ccc(C2c3[nH]c4ccccc4c3CCN2S(=O)(=O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C26H26N2O2S/c1-17-8-11-20(12-9-17)26-25-23(22-6-4-5-7-24(22)27-25)14-15-28(26)31(29,30)21-13-10-18(2)19(3)16-21/h4-13,16,26-27H,14-15H2,1-3H3 |
| InChIKey | VIILWIWTGBOHLH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|