C26H25ClN2O2S — CID 92870612
(1S)-1-(4-chlorophenyl)-2-(4-propan-2-ylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 92870612) has the molecular formula C26H25ClN2O2S and a molecular weight of 465.02 g/mol. Its IUPAC name is (1S)-1-(4-chlorophenyl)-2-(4-propan-2-ylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S)-1-(4-chlorophenyl)-2-(4-propan-2-ylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 92870612 |
| Molecular Formula | C26H25ClN2O2S |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (1S)-1-(4-chlorophenyl)-2-(4-propan-2-ylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CCc3c([nH]c4ccccc34)[C@@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H25ClN2O2S/c1-17(2)18-9-13-21(14-10-18)32(30,31)29-16-15-23-22-5-3-4-6-24(22)28-25(23)26(29)19-7-11-20(27)12-8-19/h3-14,17,26,28H,15-16H2,1-2H3/t26-/m0/s1 |
| InChIKey | YPEOTLSFTACKFH-SANMLTNESA-N |
| XLogP | 6.28 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|