C26H26Cl2N2O3S — CID 145496103
6-chloro-2-(2-chlorophenyl)sulfonyl-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole;ethane (PubChem CID 145496103) has the molecular formula C26H26Cl2N2O3S and a molecular weight of 517.48 g/mol. Its IUPAC name is 6-chloro-2-(2-chlorophenyl)sulfonyl-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole;ethane.
| Compound Name | 6-chloro-2-(2-chlorophenyl)sulfonyl-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole;ethane |
|---|---|
| PubChem CID | 145496103 |
| Molecular Formula | C26H26Cl2N2O3S |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 6-chloro-2-(2-chlorophenyl)sulfonyl-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole;ethane |
| SMILES | CC.COc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2S(=O)(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C24H20Cl2N2O3S.C2H6/c1-31-17-9-6-15(7-10-17)24-23-18(19-14-16(25)8-11-21(19)27-23)12-13-28(24)32(29,30)22-5-3-2-4-20(22)26;1-2/h2-11,14,24,27H,12-13H2,1H3;1-2H3 |
| InChIKey | HXSIHEAKNFSZSB-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|