C19H18ClFN2O3S — CID 6991296
(1S)-2-(3-chloro-4-fluorophenyl)sulfonyl-6-methoxy-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 6991296) has the molecular formula C19H18ClFN2O3S and a molecular weight of 408.88 g/mol. Its IUPAC name is (1S)-2-(3-chloro-4-fluorophenyl)sulfonyl-6-methoxy-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S)-2-(3-chloro-4-fluorophenyl)sulfonyl-6-methoxy-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 6991296 |
| Molecular Formula | C19H18ClFN2O3S |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | (1S)-2-(3-chloro-4-fluorophenyl)sulfonyl-6-methoxy-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(S(=O)(=O)c1ccc(F)c(Cl)c1)[C@H]3C |
| InChI | InChI=1S/C19H18ClFN2O3S/c1-11-19-14(15-9-12(26-2)3-6-18(15)22-19)7-8-23(11)27(24,25)13-4-5-17(21)16(20)10-13/h3-6,9-11,22H,7-8H2,1-2H3/t11-/m0/s1 |
| InChIKey | UNIFWDHKNQYPFJ-NSHDSACASA-N |
| XLogP | 4.28 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|