C13H15ClN2 — CID 66911739
6-chloro-1,2-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 66911739) has the molecular formula C13H15ClN2 and a molecular weight of 234.73 g/mol. Its IUPAC name is 6-chloro-1,2-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 6-chloro-1,2-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 66911739 |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 6-chloro-1,2-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC1c2[nH]c3ccc(Cl)cc3c2CCN1C |
| InChI | InChI=1S/C13H15ClN2/c1-8-13-10(5-6-16(8)2)11-7-9(14)3-4-12(11)15-13/h3-4,7-8,15H,5-6H2,1-2H3 |
| InChIKey | UTSSRRATBCCLAI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|