C13H16N2O — CID 45097462
1,2-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-ol (PubChem CID 45097462) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 1,2-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-ol.
| Compound Name | 1,2-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-ol |
|---|---|
| PubChem CID | 45097462 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1,2-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-ol |
| SMILES | CC1c2[nH]c3ccc(O)cc3c2CCN1C |
| InChI | InChI=1S/C13H16N2O/c1-8-13-10(5-6-15(8)2)11-7-9(16)3-4-12(11)14-13/h3-4,7-8,14,16H,5-6H2,1-2H3 |
| InChIKey | DHKNXMXSWDQULD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|