C19H16N4O4 — CID 178153750
7-hydroxy-21-methyl-17-nitro-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-14-one (PubChem CID 178153750) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is 7-hydroxy-21-methyl-17-nitro-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-14-one.
| Compound Name | 7-hydroxy-21-methyl-17-nitro-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-14-one |
|---|---|
| PubChem CID | 178153750 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 7-hydroxy-21-methyl-17-nitro-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-14-one |
| SMILES | CN1c2ccc([N+](=O)[O-])cc2C(=O)N2CCc3c([nH]c4ccc(O)cc34)C21 |
| InChI | InChI=1S/C19H16N4O4/c1-21-16-5-2-10(23(26)27)8-14(16)19(25)22-7-6-12-13-9-11(24)3-4-15(13)20-17(12)18(21)22/h2-5,8-9,18,20,24H,6-7H2,1H3 |
| InChIKey | AZPNVWRBIHUZKO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 102.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|