C18H12Cl2N2O3 — CID 86293924
16,18-dichloro-7-hydroxy-21-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-14-one (PubChem CID 86293924) has the molecular formula C18H12Cl2N2O3 and a molecular weight of 375.21 g/mol. Its IUPAC name is 16,18-dichloro-7-hydroxy-21-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-14-one.
| Compound Name | 16,18-dichloro-7-hydroxy-21-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-14-one |
|---|---|
| PubChem CID | 86293924 |
| Molecular Formula | C18H12Cl2N2O3 |
| Molecular Weight | 375.21 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 16,18-dichloro-7-hydroxy-21-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-14-one |
| SMILES | O=C1c2c(Cl)cc(Cl)cc2OC2c3[nH]c4ccc(O)cc4c3CCN12 |
| InChI | InChI=1S/C18H12Cl2N2O3/c19-8-5-12(20)15-14(6-8)25-18-16-10(3-4-22(18)17(15)24)11-7-9(23)1-2-13(11)21-16/h1-2,5-7,18,21,23H,3-4H2 |
| InChIKey | RECSBVBVNBHHDC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.21 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|