C18H14ClN3O — CID 155814782
7-chloro-3,13,15-triazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4(9),5,7,16,18,20-heptaen-14-one (PubChem CID 155814782) has the molecular formula C18H14ClN3O and a molecular weight of 323.78 g/mol. Its IUPAC name is 7-chloro-3,13,15-triazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4(9),5,7,16,18,20-heptaen-14-one.
| Compound Name | 7-chloro-3,13,15-triazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4(9),5,7,16,18,20-heptaen-14-one |
|---|---|
| PubChem CID | 155814782 |
| Molecular Formula | C18H14ClN3O |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 7-chloro-3,13,15-triazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4(9),5,7,16,18,20-heptaen-14-one |
| SMILES | O=C1Nc2ccccc2C2c3[nH]c4ccc(Cl)cc4c3CCN12 |
| InChI | InChI=1S/C18H14ClN3O/c19-10-5-6-15-13(9-10)11-7-8-22-17(16(11)20-15)12-3-1-2-4-14(12)21-18(22)23/h1-6,9,17,20H,7-8H2,(H,21,23) |
| InChIKey | LRUWYRCUSRWLFR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|