C21H20Cl2N2O2 — CID 123849864
6-chloro-1-(2-chlorophenyl)-2-(3-ethoxyoxiran-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 123849864) has the molecular formula C21H20Cl2N2O2 and a molecular weight of 403.31 g/mol. Its IUPAC name is 6-chloro-1-(2-chlorophenyl)-2-(3-ethoxyoxiran-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 6-chloro-1-(2-chlorophenyl)-2-(3-ethoxyoxiran-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 123849864 |
| Molecular Formula | C21H20Cl2N2O2 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 6-chloro-1-(2-chlorophenyl)-2-(3-ethoxyoxiran-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCOC1OC1N1CCc2c([nH]c3ccc(Cl)cc23)C1c1ccccc1Cl |
| InChI | InChI=1S/C21H20Cl2N2O2/c1-2-26-21-20(27-21)25-10-9-13-15-11-12(22)7-8-17(15)24-18(13)19(25)14-5-3-4-6-16(14)23/h3-8,11,19-21,24H,2,9-10H2,1H3 |
| InChIKey | IVERLFMJAMXJAC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 40.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|