C19H19ClN2 — CID 11738439
1-(2-chlorophenyl)-2,6-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 11738439) has the molecular formula C19H19ClN2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2,6-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(2-chlorophenyl)-2,6-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 11738439 |
| Molecular Formula | C19H19ClN2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1-(2-chlorophenyl)-2,6-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCN(C)C3c1ccccc1Cl |
| InChI | InChI=1S/C19H19ClN2/c1-12-7-8-17-15(11-12)13-9-10-22(2)19(18(13)21-17)14-5-3-4-6-16(14)20/h3-8,11,19,21H,9-10H2,1-2H3 |
| InChIKey | MHEURGKOVNSIMH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|