C24H20ClN3O — CID 45196114
[1-(2-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(6-methyl-2-pyridinyl)methanone (PubChem CID 45196114) has the molecular formula C24H20ClN3O and a molecular weight of 401.90 g/mol. Its IUPAC name is [1-(2-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(6-methyl-2-pyridinyl)methanone.
| Compound Name | [1-(2-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(6-methyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 45196114 |
| Molecular Formula | C24H20ClN3O |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [1-(2-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(6-methyl-2-pyridinyl)methanone |
| SMILES | Cc1cccc(C(=O)N2CCc3c([nH]c4ccccc34)C2c2ccccc2Cl)n1 |
| InChI | InChI=1S/C24H20ClN3O/c1-15-7-6-12-21(26-15)24(29)28-14-13-17-16-8-3-5-11-20(16)27-22(17)23(28)18-9-2-4-10-19(18)25/h2-12,23,27H,13-14H2,1H3 |
| InChIKey | VQOWXFRZSBIEEC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|