C25H26N4O3 — CID 45190684
[1-(2,3-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(2,5-dimethylpyrazol-3-yl)methanone (PubChem CID 45190684) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is [1-(2,3-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(2,5-dimethylpyrazol-3-yl)methanone.
| Compound Name | [1-(2,3-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(2,5-dimethylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 45190684 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | [1-(2,3-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(2,5-dimethylpyrazol-3-yl)methanone |
| SMILES | COc1cccc(C2c3[nH]c4ccccc4c3CCN2C(=O)c2cc(C)nn2C)c1OC |
| InChI | InChI=1S/C25H26N4O3/c1-15-14-20(28(2)27-15)25(30)29-13-12-17-16-8-5-6-10-19(16)26-22(17)23(29)18-9-7-11-21(31-3)24(18)32-4/h5-11,14,23,26H,12-13H2,1-4H3 |
| InChIKey | XRUFFTSHTSDSEX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|