C26H29N5O3 — CID 44761897
2-[1-(2,5-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-N-(2,5-dimethylpyrazol-3-yl)acetamide (PubChem CID 44761897) has the molecular formula C26H29N5O3 and a molecular weight of 459.55 g/mol. Its IUPAC name is 2-[1-(2,5-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-N-(2,5-dimethylpyrazol-3-yl)acetamide.
| Compound Name | 2-[1-(2,5-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-N-(2,5-dimethylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 44761897 |
| Molecular Formula | C26H29N5O3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 2-[1-(2,5-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-N-(2,5-dimethylpyrazol-3-yl)acetamide |
| SMILES | COc1ccc(OC)c(C2c3[nH]c4ccccc4c3CCN2CC(=O)Nc2cc(C)nn2C)c1 |
| InChI | InChI=1S/C26H29N5O3/c1-16-13-23(30(2)29-16)28-24(32)15-31-12-11-19-18-7-5-6-8-21(18)27-25(19)26(31)20-14-17(33-3)9-10-22(20)34-4/h5-10,13-14,26-27H,11-12,15H2,1-4H3,(H,28,32) |
| InChIKey | NMXQPCIJCJZOJX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 84.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|