C22H20FN5O2 — CID 42121348
1-[(1R)-1-(2-fluoro-4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(1,2,4-triazol-1-yl)ethanone (PubChem CID 42121348) has the molecular formula C22H20FN5O2 and a molecular weight of 405.43 g/mol. Its IUPAC name is 1-[(1R)-1-(2-fluoro-4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(1,2,4-triazol-1-yl)ethanone.
| Compound Name | 1-[(1R)-1-(2-fluoro-4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(1,2,4-triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 42121348 |
| Molecular Formula | C22H20FN5O2 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 1-[(1R)-1-(2-fluoro-4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(1,2,4-triazol-1-yl)ethanone |
| SMILES | COc1ccc([C@@H]2c3[nH]c4ccccc4c3CCN2C(=O)Cn2cncn2)c(F)c1 |
| InChI | InChI=1S/C22H20FN5O2/c1-30-14-6-7-17(18(23)10-14)22-21-16(15-4-2-3-5-19(15)26-21)8-9-28(22)20(29)11-27-13-24-12-25-27/h2-7,10,12-13,22,26H,8-9,11H2,1H3/t22-/m1/s1 |
| InChIKey | BIZANPPKLLTFGD-JOCHJYFZSA-N |
| XLogP | 3.08 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|