C23H18ClFN4O2 — CID 42567526
6-chloro-2-[2-[(1R)-1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]pyridazin-3-one (PubChem CID 42567526) has the molecular formula C23H18ClFN4O2 and a molecular weight of 436.87 g/mol. Its IUPAC name is 6-chloro-2-[2-[(1R)-1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]pyridazin-3-one.
| Compound Name | 6-chloro-2-[2-[(1R)-1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 42567526 |
| Molecular Formula | C23H18ClFN4O2 |
| Molecular Weight | 436.87 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 6-chloro-2-[2-[(1R)-1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]pyridazin-3-one |
| SMILES | O=C(Cn1nc(Cl)ccc1=O)N1CCc2c([nH]c3ccccc23)[C@H]1c1ccccc1F |
| InChI | InChI=1S/C23H18ClFN4O2/c24-19-9-10-20(30)29(27-19)13-21(31)28-12-11-15-14-5-2-4-8-18(14)26-22(15)23(28)16-6-1-3-7-17(16)25/h1-10,23,26H,11-13H2/t23-/m1/s1 |
| InChIKey | YVWYSVRWJPWQSH-HSZRJFAPSA-N |
| XLogP | 3.69 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.87 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|