C24H19FN2O2S — CID 45239960
1-[4-[1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]thiophen-2-yl]ethanone (PubChem CID 45239960) has the molecular formula C24H19FN2O2S and a molecular weight of 418.49 g/mol. Its IUPAC name is 1-[4-[1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]thiophen-2-yl]ethanone.
| Compound Name | 1-[4-[1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 45239960 |
| Molecular Formula | C24H19FN2O2S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 1-[4-[1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1cc(C(=O)N2CCc3c([nH]c4ccccc34)C2c2ccccc2F)cs1 |
| InChI | InChI=1S/C24H19FN2O2S/c1-14(28)21-12-15(13-30-21)24(29)27-11-10-17-16-6-3-5-9-20(16)26-22(17)23(27)18-7-2-4-8-19(18)25/h2-9,12-13,23,26H,10-11H2,1H3 |
| InChIKey | QQCLJJPLEGDOQK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|