C23H21FN4O — CID 25366234
(1-ethylpyrazol-4-yl)-[(1R)-1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 25366234) has the molecular formula C23H21FN4O and a molecular weight of 388.45 g/mol. Its IUPAC name is (1-ethylpyrazol-4-yl)-[(1R)-1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | (1-ethylpyrazol-4-yl)-[(1R)-1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 25366234 |
| Molecular Formula | C23H21FN4O |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (1-ethylpyrazol-4-yl)-[(1R)-1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | CCn1cc(C(=O)N2CCc3c([nH]c4ccccc34)[C@H]2c2ccccc2F)cn1 |
| InChI | InChI=1S/C23H21FN4O/c1-2-27-14-15(13-25-27)23(29)28-12-11-17-16-7-4-6-10-20(16)26-21(17)22(28)18-8-3-5-9-19(18)24/h3-10,13-14,22,26H,2,11-12H2,1H3/t22-/m1/s1 |
| InChIKey | CSNVRNOBDGRKJN-JOCHJYFZSA-N |
| XLogP | 4.31 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|