C27H19FN2O3 — CID 25461488
2-[(1R)-1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]chromen-4-one (PubChem CID 25461488) has the molecular formula C27H19FN2O3 and a molecular weight of 438.46 g/mol. Its IUPAC name is 2-[(1R)-1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]chromen-4-one.
| Compound Name | 2-[(1R)-1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]chromen-4-one |
|---|---|
| PubChem CID | 25461488 |
| Molecular Formula | C27H19FN2O3 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 2-[(1R)-1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]chromen-4-one |
| SMILES | O=C(c1cc(=O)c2ccccc2o1)N1CCc2c([nH]c3ccccc23)[C@H]1c1ccccc1F |
| InChI | InChI=1S/C27H19FN2O3/c28-20-10-4-1-8-18(20)26-25-17(16-7-2-5-11-21(16)29-25)13-14-30(26)27(32)24-15-22(31)19-9-3-6-12-23(19)33-24/h1-12,15,26,29H,13-14H2/t26-/m1/s1 |
| InChIKey | PCRFZDRKCQQXDU-AREMUKBSSA-N |
| XLogP | 5.20 |
| TPSA | 66.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|