C24H19ClFN3O — CID 20920705
N-(2-chlorophenyl)-1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 20920705) has the molecular formula C24H19ClFN3O and a molecular weight of 419.89 g/mol. Its IUPAC name is N-(2-chlorophenyl)-1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-(2-chlorophenyl)-1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 20920705 |
| Molecular Formula | C24H19ClFN3O |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-(2-chlorophenyl)-1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)N1CCc2c([nH]c3ccccc23)C1c1ccccc1F |
| InChI | InChI=1S/C24H19ClFN3O/c25-18-9-3-6-12-21(18)28-24(30)29-14-13-16-15-7-2-5-11-20(15)27-22(16)23(29)17-8-1-4-10-19(17)26/h1-12,23,27H,13-14H2,(H,28,30) |
| InChIKey | AJSLRTHEOXXYME-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|