C26H21ClFN3O3 — CID 92745414
methyl 4-chloro-2-[[(1R)-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate (PubChem CID 92745414) has the molecular formula C26H21ClFN3O3 and a molecular weight of 477.92 g/mol. Its IUPAC name is methyl 4-chloro-2-[[(1R)-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate.
| Compound Name | methyl 4-chloro-2-[[(1R)-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 92745414 |
| Molecular Formula | C26H21ClFN3O3 |
| Molecular Weight | 477.92 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | methyl 4-chloro-2-[[(1R)-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)cc1NC(=O)N1CCc2c([nH]c3ccccc23)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C26H21ClFN3O3/c1-34-25(32)20-11-8-16(27)14-22(20)30-26(33)31-13-12-19-18-4-2-3-5-21(18)29-23(19)24(31)15-6-9-17(28)10-7-15/h2-11,14,24,29H,12-13H2,1H3,(H,30,33)/t24-/m1/s1 |
| InChIKey | VJGTYBOYBNEYJV-XMMPIXPASA-N |
| XLogP | 5.93 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.92 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|