C26H18Br2N2O2 — CID 166628236
(5-bromo-1-benzofuran-2-yl)-[(1R)-1-(4-bromophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 166628236) has the molecular formula C26H18Br2N2O2 and a molecular weight of 550.25 g/mol. Its IUPAC name is (5-bromo-1-benzofuran-2-yl)-[(1R)-1-(4-bromophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | (5-bromo-1-benzofuran-2-yl)-[(1R)-1-(4-bromophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 166628236 |
| Molecular Formula | C26H18Br2N2O2 |
| Molecular Weight | 550.25 g/mol |
| Exact Mass | 547.97 |
| IUPAC Name | (5-bromo-1-benzofuran-2-yl)-[(1R)-1-(4-bromophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | O=C(c1cc2cc(Br)ccc2o1)N1CCc2c([nH]c3ccccc23)[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H18Br2N2O2/c27-17-7-5-15(6-8-17)25-24-20(19-3-1-2-4-21(19)29-24)11-12-30(25)26(31)23-14-16-13-18(28)9-10-22(16)32-23/h1-10,13-14,25,29H,11-12H2/t25-/m1/s1 |
| InChIKey | XWXCKXQORVUCSO-RUZDIDTESA-N |
| XLogP | 7.23 |
| TPSA | 49.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.25 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|