C26H18BrN3O4 — CID 3351069
(5-bromo-1-benzofuran-2-yl)-[1-(4-nitrophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 3351069) has the molecular formula C26H18BrN3O4 and a molecular weight of 516.35 g/mol. Its IUPAC name is (5-bromo-1-benzofuran-2-yl)-[1-(4-nitrophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | (5-bromo-1-benzofuran-2-yl)-[1-(4-nitrophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 3351069 |
| Molecular Formula | C26H18BrN3O4 |
| Molecular Weight | 516.35 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | (5-bromo-1-benzofuran-2-yl)-[1-(4-nitrophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | O=C(c1cc2cc(Br)ccc2o1)N1CCc2c([nH]c3ccccc23)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H18BrN3O4/c27-17-7-10-22-16(13-17)14-23(34-22)26(31)29-12-11-20-19-3-1-2-4-21(19)28-24(20)25(29)15-5-8-18(9-6-15)30(32)33/h1-10,13-14,25,28H,11-12H2 |
| InChIKey | WVFWIDPUKVMPLC-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 92.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.35 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|