C25H29N3O3 — CID 59684289
2-ethyl-1-[1-(4-nitrophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]hexan-1-one (PubChem CID 59684289) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-ethyl-1-[1-(4-nitrophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]hexan-1-one.
| Compound Name | 2-ethyl-1-[1-(4-nitrophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]hexan-1-one |
|---|---|
| PubChem CID | 59684289 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-ethyl-1-[1-(4-nitrophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]hexan-1-one |
| SMILES | CCCCC(CC)C(=O)N1CCc2c([nH]c3ccccc23)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H29N3O3/c1-3-5-8-17(4-2)25(29)27-16-15-21-20-9-6-7-10-22(20)26-23(21)24(27)18-11-13-19(14-12-18)28(30)31/h6-7,9-14,17,24,26H,3-5,8,15-16H2,1-2H3 |
| InChIKey | OOTOOUSGFHWALJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|