C23H26N2O2 — CID 42394750
1-[(1R)-1-(4-ethylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-hydroxy-2-methylpropan-1-one (PubChem CID 42394750) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-[(1R)-1-(4-ethylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-hydroxy-2-methylpropan-1-one.
| Compound Name | 1-[(1R)-1-(4-ethylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-hydroxy-2-methylpropan-1-one |
|---|---|
| PubChem CID | 42394750 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-[(1R)-1-(4-ethylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-hydroxy-2-methylpropan-1-one |
| SMILES | CCc1ccc([C@@H]2c3[nH]c4ccccc4c3CCN2C(=O)C(C)(C)O)cc1 |
| InChI | InChI=1S/C23H26N2O2/c1-4-15-9-11-16(12-10-15)21-20-18(17-7-5-6-8-19(17)24-20)13-14-25(21)22(26)23(2,3)27/h5-12,21,24,27H,4,13-14H2,1-3H3/t21-/m1/s1 |
| InChIKey | JVSUUFWSWGDEGZ-OAQYLSRUSA-N |
| XLogP | 3.98 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|