C21H21BrN2 — CID 164561394
1-(4-bromophenyl)-2-but-1-en-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 164561394) has the molecular formula C21H21BrN2 and a molecular weight of 381.32 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-but-1-en-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(4-bromophenyl)-2-but-1-en-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 164561394 |
| Molecular Formula | C21H21BrN2 |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 1-(4-bromophenyl)-2-but-1-en-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C=C(CC)N1CCc2c([nH]c3ccccc23)C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H21BrN2/c1-3-14(2)24-13-12-18-17-6-4-5-7-19(17)23-20(18)21(24)15-8-10-16(22)11-9-15/h4-11,21,23H,2-3,12-13H2,1H3 |
| InChIKey | KAMKFGBUJGVMOK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|