C25H22N2OS — CID 46359950
[1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-phenylmethanone (PubChem CID 46359950) has the molecular formula C25H22N2OS and a molecular weight of 398.53 g/mol. Its IUPAC name is [1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-phenylmethanone.
| Compound Name | [1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 46359950 |
| Molecular Formula | C25H22N2OS |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | [1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-phenylmethanone |
| SMILES | CSc1ccc(C2c3[nH]c4ccccc4c3CCN2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N2OS/c1-29-19-13-11-17(12-14-19)24-23-21(20-9-5-6-10-22(20)26-23)15-16-27(24)25(28)18-7-3-2-4-8-18/h2-14,24,26H,15-16H2,1H3 |
| InChIKey | RHJDVJGSJAGWMO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|