C25H19N3O — CID 25217360
4-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)benzonitrile (PubChem CID 25217360) has the molecular formula C25H19N3O and a molecular weight of 377.45 g/mol. Its IUPAC name is 4-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)benzonitrile.
| Compound Name | 4-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)benzonitrile |
|---|---|
| PubChem CID | 25217360 |
| Molecular Formula | C25H19N3O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 4-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)benzonitrile |
| SMILES | N#Cc1ccc(C(=O)N2CCc3c([nH]c4ccccc34)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H19N3O/c26-16-17-10-12-19(13-11-17)25(29)28-15-14-21-20-8-4-5-9-22(20)27-23(21)24(28)18-6-2-1-3-7-18/h1-13,24,27H,14-15H2 |
| InChIKey | QYUVIUFCULUIBC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|