C21H22N2O — CID 92730348
1-[(1S)-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one (PubChem CID 92730348) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[(1S)-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one.
| Compound Name | 1-[(1S)-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one |
|---|---|
| PubChem CID | 92730348 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 1-[(1S)-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCc2c([nH]c3ccccc23)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H22N2O/c1-2-8-19(24)23-14-13-17-16-11-6-7-12-18(16)22-20(17)21(23)15-9-4-3-5-10-15/h3-7,9-12,21-22H,2,8,13-14H2,1H3/t21-/m0/s1 |
| InChIKey | GSWKAVYSENRQSD-NRFANRHFSA-N |
| XLogP | 4.44 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|