C19H18N2O2 — CID 67696379
(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl) acetate (PubChem CID 67696379) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl) acetate.
| Compound Name | (1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl) acetate |
|---|---|
| PubChem CID | 67696379 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl) acetate |
| SMILES | CC(=O)ON1CCc2c([nH]c3ccccc23)C1c1ccccc1 |
| InChI | InChI=1S/C19H18N2O2/c1-13(22)23-21-12-11-16-15-9-5-6-10-17(15)20-18(16)19(21)14-7-3-2-4-8-14/h2-10,19-20H,11-12H2,1H3 |
| InChIKey | HUBZLOKAFBQLIP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|