C21H24N2 — CID 118880821
2-tert-butyl-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 118880821) has the molecular formula C21H24N2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 2-tert-butyl-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-tert-butyl-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 118880821 |
| Molecular Formula | C21H24N2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 2-tert-butyl-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC(C)(C)N1CCc2c([nH]c3ccccc23)C1c1ccccc1 |
| InChI | InChI=1S/C21H24N2/c1-21(2,3)23-14-13-17-16-11-7-8-12-18(16)22-19(17)20(23)15-9-5-4-6-10-15/h4-12,20,22H,13-14H2,1-3H3 |
| InChIKey | UFVOVFRYEBVTER-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|