C29H26N2 — CID 10993114
(1R)-2-[(1R)-1-naphthalen-1-ylethyl]-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 10993114) has the molecular formula C29H26N2 and a molecular weight of 402.54 g/mol. Its IUPAC name is (1R)-2-[(1R)-1-naphthalen-1-ylethyl]-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R)-2-[(1R)-1-naphthalen-1-ylethyl]-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 10993114 |
| Molecular Formula | C29H26N2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (1R)-2-[(1R)-1-naphthalen-1-ylethyl]-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@H](c1cccc2ccccc12)N1CCc2c([nH]c3ccccc23)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C29H26N2/c1-20(23-16-9-13-21-10-5-6-14-24(21)23)31-19-18-26-25-15-7-8-17-27(25)30-28(26)29(31)22-11-3-2-4-12-22/h2-17,20,29-30H,18-19H2,1H3/t20-,29-/m1/s1 |
| InChIKey | SDIAOZCMCHFLRB-ACSYHNTCSA-N |
| XLogP | 7.03 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|