C31H28N2O — CID 11339751
(1S)-1-(2,3-dihydro-1-benzofuran-5-yl)-2-[(1R)-1-naphthalen-1-ylethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 11339751) has the molecular formula C31H28N2O and a molecular weight of 444.58 g/mol. Its IUPAC name is (1S)-1-(2,3-dihydro-1-benzofuran-5-yl)-2-[(1R)-1-naphthalen-1-ylethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S)-1-(2,3-dihydro-1-benzofuran-5-yl)-2-[(1R)-1-naphthalen-1-ylethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 11339751 |
| Molecular Formula | C31H28N2O |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | (1S)-1-(2,3-dihydro-1-benzofuran-5-yl)-2-[(1R)-1-naphthalen-1-ylethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@H](c1cccc2ccccc12)N1CCc2c([nH]c3ccccc23)[C@@H]1c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C31H28N2O/c1-20(24-11-6-8-21-7-2-3-9-25(21)24)33-17-15-27-26-10-4-5-12-28(26)32-30(27)31(33)23-13-14-29-22(19-23)16-18-34-29/h2-14,19-20,31-32H,15-18H2,1H3/t20-,31+/m1/s1 |
| InChIKey | HACSKKCXYKBZSG-QJWGWKRISA-N |
| XLogP | 6.96 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|