C27H26N2O3 — CID 92730536
[(1S)-1-(3-ethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-methoxyphenyl)methanone (PubChem CID 92730536) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is [(1S)-1-(3-ethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [(1S)-1-(3-ethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 92730536 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [(1S)-1-(3-ethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-methoxyphenyl)methanone |
| SMILES | CCOc1cccc([C@H]2c3[nH]c4ccccc4c3CCN2C(=O)c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C27H26N2O3/c1-3-32-21-8-6-7-19(17-21)26-25-23(22-9-4-5-10-24(22)28-25)15-16-29(26)27(30)18-11-13-20(31-2)14-12-18/h4-14,17,26,28H,3,15-16H2,1-2H3/t26-/m0/s1 |
| InChIKey | ZDQMNLBFIRUBDK-SANMLTNESA-N |
| XLogP | 5.36 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|