C24H24N4O2 — CID 50806661
[1-(3-ethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(2-methylpyrazol-3-yl)methanone (PubChem CID 50806661) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is [1-(3-ethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(2-methylpyrazol-3-yl)methanone.
| Compound Name | [1-(3-ethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(2-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 50806661 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [1-(3-ethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(2-methylpyrazol-3-yl)methanone |
| SMILES | CCOc1cccc(C2c3[nH]c4ccccc4c3CCN2C(=O)c2ccnn2C)c1 |
| InChI | InChI=1S/C24H24N4O2/c1-3-30-17-8-6-7-16(15-17)23-22-19(18-9-4-5-10-20(18)26-22)12-14-28(23)24(29)21-11-13-25-27(21)2/h4-11,13,15,23,26H,3,12,14H2,1-2H3 |
| InChIKey | OXFOXTUYYYAMCI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|