C17H18N4O — CID 94825109
(2-methylpyrazol-3-yl)-[(1R)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 94825109) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is (2-methylpyrazol-3-yl)-[(1R)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | (2-methylpyrazol-3-yl)-[(1R)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 94825109 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (2-methylpyrazol-3-yl)-[(1R)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | C[C@@H]1c2[nH]c3ccccc3c2CCN1C(=O)c1ccnn1C |
| InChI | InChI=1S/C17H18N4O/c1-11-16-13(12-5-3-4-6-14(12)19-16)8-10-21(11)17(22)15-7-9-18-20(15)2/h3-7,9,11,19H,8,10H2,1-2H3/t11-/m1/s1 |
| InChIKey | QZKZHYOUQBOQFV-LLVKDONJSA-N |
| XLogP | 2.66 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|