C16H20N4O2 — CID 94639268
[(2R)-1-[(1S)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-oxopropan-2-yl]urea (PubChem CID 94639268) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is [(2R)-1-[(1S)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-oxopropan-2-yl]urea.
| Compound Name | [(2R)-1-[(1S)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-oxopropan-2-yl]urea |
|---|---|
| PubChem CID | 94639268 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | [(2R)-1-[(1S)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-oxopropan-2-yl]urea |
| SMILES | C[C@@H](NC(N)=O)C(=O)N1CCc2c([nH]c3ccccc23)[C@@H]1C |
| InChI | InChI=1S/C16H20N4O2/c1-9(18-16(17)22)15(21)20-8-7-12-11-5-3-4-6-13(11)19-14(12)10(20)2/h3-6,9-10,19H,7-8H2,1-2H3,(H3,17,18,22)/t9-,10+/m1/s1 |
| InChIKey | FTTRONTXHUJQDX-ZJUUUORDSA-N |
| XLogP | 1.67 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|