C32H28N2O8 — CID 101236954
[(2R,3S)-2-benzoyloxy-1-methoxy-5-[(1R)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1,4,5-trioxopentan-3-yl] benzoate (PubChem CID 101236954) has the molecular formula C32H28N2O8 and a molecular weight of 568.58 g/mol. Its IUPAC name is [(2R,3S)-2-benzoyloxy-1-methoxy-5-[(1R)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1,4,5-trioxopentan-3-yl] benzoate.
| Compound Name | [(2R,3S)-2-benzoyloxy-1-methoxy-5-[(1R)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1,4,5-trioxopentan-3-yl] benzoate |
|---|---|
| PubChem CID | 101236954 |
| Molecular Formula | C32H28N2O8 |
| Molecular Weight | 568.58 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | [(2R,3S)-2-benzoyloxy-1-methoxy-5-[(1R)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1,4,5-trioxopentan-3-yl] benzoate |
| SMILES | COC(=O)[C@H](OC(=O)c1ccccc1)[C@H](OC(=O)c1ccccc1)C(=O)C(=O)N1CCc2c([nH]c3ccccc23)[C@H]1C |
| InChI | InChI=1S/C32H28N2O8/c1-19-25-23(22-15-9-10-16-24(22)33-25)17-18-34(19)29(36)26(35)27(41-30(37)20-11-5-3-6-12-20)28(32(39)40-2)42-31(38)21-13-7-4-8-14-21/h3-16,19,27-28,33H,17-18H2,1-2H3/t19-,27-,28-/m1/s1 |
| InChIKey | QYXVVOLKCKQCII-OYZWHMGFSA-N |
| XLogP | 3.81 |
| TPSA | 132.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|