C20H27N3O2 — CID 51088391
N-[6-(1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-6-oxohexyl]acetamide (PubChem CID 51088391) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is N-[6-(1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-6-oxohexyl]acetamide.
| Compound Name | N-[6-(1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-6-oxohexyl]acetamide |
|---|---|
| PubChem CID | 51088391 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-[6-(1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-6-oxohexyl]acetamide |
| SMILES | CC(=O)NCCCCCC(=O)N1CCc2c([nH]c3ccccc23)C1C |
| InChI | InChI=1S/C20H27N3O2/c1-14-20-17(16-8-5-6-9-18(16)22-20)11-13-23(14)19(25)10-4-3-7-12-21-15(2)24/h5-6,8-9,14,22H,3-4,7,10-13H2,1-2H3,(H,21,24) |
| InChIKey | XBKPXFAWQKHBPI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|