C34H46N4O5 — CID 143322204
cyclopentyl (2S)-2-(methylamino)-2-phenylacetate;N-hydroxy-8-(1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-8-oxooctanamide (PubChem CID 143322204) has the molecular formula C34H46N4O5 and a molecular weight of 590.77 g/mol. Its IUPAC name is cyclopentyl (2S)-2-(methylamino)-2-phenylacetate;N-hydroxy-8-(1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-8-oxooctanamide.
| Compound Name | cyclopentyl (2S)-2-(methylamino)-2-phenylacetate;N-hydroxy-8-(1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-8-oxooctanamide |
|---|---|
| PubChem CID | 143322204 |
| Molecular Formula | C34H46N4O5 |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.35 |
| IUPAC Name | cyclopentyl (2S)-2-(methylamino)-2-phenylacetate;N-hydroxy-8-(1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-8-oxooctanamide |
| SMILES | CC1c2[nH]c3ccccc3c2CCN1C(=O)CCCCCCC(=O)NO.CN[C@H](C(=O)OC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H27N3O3.C14H19NO2/c1-14-20-16(15-8-6-7-9-17(15)21-20)12-13-23(14)19(25)11-5-3-2-4-10-18(24)22-26;1-15-13(11-7-3-2-4-8-11)14(16)17-12-9-5-6-10-12/h6-9,14,21,26H,2-5,10-13H2,1H3,(H,22,24);2-4,7-8,12-13,15H,5-6,9-10H2,1H3/t;13-/m.0/s1 |
| InChIKey | RAEYXHVNGAIQHB-RSJBZBQMSA-N |
| XLogP | 5.89 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|