C22H28N2O3 — CID 110666295
methyl 4-(1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-4-oxobutanoate (PubChem CID 110666295) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is methyl 4-(1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-4-oxobutanoate.
| Compound Name | methyl 4-(1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 110666295 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | methyl 4-(1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N1CCc2c([nH]c3ccccc23)C1C1CCCCC1 |
| InChI | InChI=1S/C22H28N2O3/c1-27-20(26)12-11-19(25)24-14-13-17-16-9-5-6-10-18(16)23-21(17)22(24)15-7-3-2-4-8-15/h5-6,9-10,15,22-23H,2-4,7-8,11-14H2,1H3 |
| InChIKey | LPZMDEKMXCXZCD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|