C25H29N3O — CID 45191530
1-(1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-3-pyridin-4-ylpropan-1-one (PubChem CID 45191530) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-(1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-3-pyridin-4-ylpropan-1-one.
| Compound Name | 1-(1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-3-pyridin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 45191530 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 1-(1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-3-pyridin-4-ylpropan-1-one |
| SMILES | O=C(CCc1ccncc1)N1CCc2c([nH]c3ccccc23)C1C1CCCCC1 |
| InChI | InChI=1S/C25H29N3O/c29-23(11-10-18-12-15-26-16-13-18)28-17-14-21-20-8-4-5-9-22(20)27-24(21)25(28)19-6-2-1-3-7-19/h4-5,8-9,12-13,15-16,19,25,27H,1-3,6-7,10-11,14,17H2 |
| InChIKey | PLUADNLMHBKTGL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|