C21H25N4O3+ — CID 45245556
3-[2-(1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-oxoethyl]-2H-oxadiazol-3-ium-5-one (PubChem CID 45245556) has the molecular formula C21H25N4O3+ and a molecular weight of 381.46 g/mol. Its IUPAC name is 3-[2-(1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-oxoethyl]-2H-oxadiazol-3-ium-5-one.
| Compound Name | 3-[2-(1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-oxoethyl]-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 45245556 |
| Molecular Formula | C21H25N4O3+ |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 3-[2-(1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-oxoethyl]-2H-oxadiazol-3-ium-5-one |
| SMILES | O=C(C[n+]1cc(=O)o[nH]1)N1CCc2c([nH]c3ccccc23)C1C1CCCCC1 |
| InChI | InChI=1S/C21H24N4O3/c26-18(12-24-13-19(27)28-23-24)25-11-10-16-15-8-4-5-9-17(15)22-20(16)21(25)14-6-2-1-3-7-14/h4-5,8-9,13-14,21-22H,1-3,6-7,10-12H2/p+1 |
| InChIKey | VFNIACMIQUPACR-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 85.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|