C23H38N2O — CID 90962597
1-[(1R,12bS)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-1-yl]ethanone;ethane (PubChem CID 90962597) has the molecular formula C23H38N2O and a molecular weight of 358.57 g/mol. Its IUPAC name is 1-[(1R,12bS)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-1-yl]ethanone;ethane.
| Compound Name | 1-[(1R,12bS)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-1-yl]ethanone;ethane |
|---|---|
| PubChem CID | 90962597 |
| Molecular Formula | C23H38N2O |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.30 |
| IUPAC Name | 1-[(1R,12bS)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-1-yl]ethanone;ethane |
| SMILES | CC.CC.CC.CC(=O)[C@@H]1CCCN2CCc3c([nH]c4ccccc34)[C@H]12 |
| InChI | InChI=1S/C17H20N2O.3C2H6/c1-11(20)12-6-4-9-19-10-8-14-13-5-2-3-7-15(13)18-16(14)17(12)19;3*1-2/h2-3,5,7,12,17-18H,4,6,8-10H2,1H3;3*1-2H3/t12-,17-;;;/m0.../s1 |
| InChIKey | CAIYOKZABNDZMF-BQDCGXNJSA-N |
| XLogP | 6.14 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|